C23H19NO5 — CID 143740046
[(Z)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-phenylprop-2-enoate (PubChem CID 143740046) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is [(Z)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-phenylprop-2-enoate.
| Compound Name | [(Z)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 143740046 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(Z)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-phenylprop-2-enoate |
| SMILES | CC1(C)Oc2cc3oc(=O)ccc3cc2C/C1=N/OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H19NO5/c1-23(2)20(24-29-22(26)10-8-15-6-4-3-5-7-15)13-17-12-16-9-11-21(25)27-18(16)14-19(17)28-23/h3-12,14H,13H2,1-2H3/b10-8+,24-20- |
| InChIKey | SVCQVENCZKUDKZ-OIYIWYIDSA-N |
| XLogP | 4.12 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|