C17H29N — CID 143746101
(3Z,5Z)-2,2,7,7-tetramethyl-4,5-di(propan-2-yl)azocine (PubChem CID 143746101) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is (3Z,5Z)-2,2,7,7-tetramethyl-4,5-di(propan-2-yl)azocine.
| Compound Name | (3Z,5Z)-2,2,7,7-tetramethyl-4,5-di(propan-2-yl)azocine |
|---|---|
| PubChem CID | 143746101 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | (3Z,5Z)-2,2,7,7-tetramethyl-4,5-di(propan-2-yl)azocine |
| SMILES | CC(C)C1=C/C(C)(C)/C=N\C(C)(C)/C=C\1C(C)C |
| InChI | InChI=1S/C17H29N/c1-12(2)14-9-16(5,6)11-18-17(7,8)10-15(14)13(3)4/h9-13H,1-8H3/b14-9-,15-10-,18-11- |
| InChIKey | PLOZEBPMPQFDBY-WQPBTFLSSA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |