C20H38O — CID 143749100
hexane;2,5,6-trimethyl-2-(4-methylpent-3-enyl)-3,4-dihydropyran (PubChem CID 143749100) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is hexane;2,5,6-trimethyl-2-(4-methylpent-3-enyl)-3,4-dihydropyran.
| Compound Name | hexane;2,5,6-trimethyl-2-(4-methylpent-3-enyl)-3,4-dihydropyran |
|---|---|
| PubChem CID | 143749100 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | hexane;2,5,6-trimethyl-2-(4-methylpent-3-enyl)-3,4-dihydropyran |
| SMILES | CC(C)=CCCC1(C)CCC(C)=C(C)O1.CCCCCC |
| InChI | InChI=1S/C14H24O.C6H14/c1-11(2)7-6-9-14(5)10-8-12(3)13(4)15-14;1-3-5-6-4-2/h7H,6,8-10H2,1-5H3;3-6H2,1-2H3 |
| InChIKey | IKXGTFSYZYIOAS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|