C10H12FN — CID 143750133
6-fluoro-1,2-dimethyl-3a,7a-dihydroindole (PubChem CID 143750133) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 6-fluoro-1,2-dimethyl-3a,7a-dihydroindole.
| Compound Name | 6-fluoro-1,2-dimethyl-3a,7a-dihydroindole |
|---|---|
| PubChem CID | 143750133 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 6-fluoro-1,2-dimethyl-3a,7a-dihydroindole |
| SMILES | CC1=CC2C=CC(F)=CC2N1C |
| InChI | InChI=1S/C10H12FN/c1-7-5-8-3-4-9(11)6-10(8)12(7)2/h3-6,8,10H,1-2H3 |
| InChIKey | ZSOTVPYBTVYSGZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |