C22H25ClFN3O4 — CID 143763488
3-[(2-chloro-3-fluorophenyl)methyl]-1-(2-hydroxyethyl)-1-methylurea;2-propylisoindole-1,3-dione (PubChem CID 143763488) has the molecular formula C22H25ClFN3O4 and a molecular weight of 449.91 g/mol. Its IUPAC name is 3-[(2-chloro-3-fluorophenyl)methyl]-1-(2-hydroxyethyl)-1-methylurea;2-propylisoindole-1,3-dione.
| Compound Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1-(2-hydroxyethyl)-1-methylurea;2-propylisoindole-1,3-dione |
|---|---|
| PubChem CID | 143763488 |
| Molecular Formula | C22H25ClFN3O4 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[(2-chloro-3-fluorophenyl)methyl]-1-(2-hydroxyethyl)-1-methylurea;2-propylisoindole-1,3-dione |
| SMILES | CCCN1C(=O)c2ccccc2C1=O.CN(CCO)C(=O)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C11H14ClFN2O2.C11H11NO2/c1-15(5-6-16)11(17)14-7-8-3-2-4-9(13)10(8)12;1-2-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h2-4,16H,5-7H2,1H3,(H,14,17);3-6H,2,7H2,1H3 |
| InChIKey | LVHBPYNEPGCLBY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|