C13H21NOS — CID 143777846
N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide (PubChem CID 143777846) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide.
| Compound Name | N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide |
|---|---|
| PubChem CID | 143777846 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(3-methylcyclohexyl)cyclohexa-1,5-diene-1-sulfinamide |
| SMILES | CC1CCCC(NS(=O)C2=CCCC=C2)C1 |
| InChI | InChI=1S/C13H21NOS/c1-11-6-5-7-12(10-11)14-16(15)13-8-3-2-4-9-13/h3,8-9,11-12,14H,2,4-7,10H2,1H3 |
| InChIKey | SEPUJFDEGQTDCO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |