C35H38O6 — CID 143780148
(1S,3E)-1-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydroindene (PubChem CID 143780148) has the molecular formula C35H38O6 and a molecular weight of 554.68 g/mol. Its IUPAC name is (1S,3E)-1-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydroindene.
| Compound Name | (1S,3E)-1-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 143780148 |
| Molecular Formula | C35H38O6 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (1S,3E)-1-(3,5-dimethoxyphenyl)-3-[(2E,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienylidene]-5,7-dimethoxy-2-(4-methoxyphenyl)-1,2-dihydroindene |
| SMILES | C=C(/C=C\C(=C/C)\C=C1\c2cc(OC)cc(OC)c2[C@H](c2cc(OC)cc(OC)c2)C1c1ccc(OC)cc1)OC |
| InChI | InChI=1S/C35H38O6/c1-9-23(11-10-22(2)36-3)16-30-31-20-29(40-7)21-32(41-8)35(31)34(25-17-27(38-5)19-28(18-25)39-6)33(30)24-12-14-26(37-4)15-13-24/h9-21,33-34H,2H2,1,3-8H3/b11-10-,23-9+,30-16-/t33?,34-/m1/s1 |
| InChIKey | DTANJNYZPDNZLA-XNGKQOABSA-N |
| XLogP | 7.70 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|