C32H30O4 — CID 71726563
(1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-phenyl-1,2-dihydroindene (PubChem CID 71726563) has the molecular formula C32H30O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-phenyl-1,2-dihydroindene.
| Compound Name | (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-phenyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 71726563 |
| Molecular Formula | C32H30O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (1R,2R,3E)-3-benzylidene-2-(3,5-dimethoxyphenyl)-5,7-dimethoxy-1-phenyl-1,2-dihydroindene |
| SMILES | COc1cc(OC)cc([C@@H]2/C(=C\c3ccccc3)c3cc(OC)cc(OC)c3[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C32H30O4/c1-33-24-16-23(17-25(18-24)34-2)30-27(15-21-11-7-5-8-12-21)28-19-26(35-3)20-29(36-4)32(28)31(30)22-13-9-6-10-14-22/h5-20,30-31H,1-4H3/b27-15-/t30-,31+/m1/s1 |
| InChIKey | SGUKOVOJIPQRDA-XKLSYVDXSA-N |
| XLogP | 7.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|