C14H12N2O2 — CID 143781226
(4S)-4-(4-hydroxyphenyl)-3,4-dihydro-2H-phthalazin-1-one (PubChem CID 143781226) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is (4S)-4-(4-hydroxyphenyl)-3,4-dihydro-2H-phthalazin-1-one.
| Compound Name | (4S)-4-(4-hydroxyphenyl)-3,4-dihydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 143781226 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (4S)-4-(4-hydroxyphenyl)-3,4-dihydro-2H-phthalazin-1-one |
| SMILES | O=C1NN[C@@H](c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C14H12N2O2/c17-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(18)16-15-13/h1-8,13,15,17H,(H,16,18)/t13-/m0/s1 |
| InChIKey | XAQRXJQLEJPCCS-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |