C25H29N7O3S — CID 143782895
8-[5-[[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]methyl]-1H-imidazol-2-yl]octan-2-one (PubChem CID 143782895) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is 8-[5-[[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]methyl]-1H-imidazol-2-yl]octan-2-one.
| Compound Name | 8-[5-[[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]methyl]-1H-imidazol-2-yl]octan-2-one |
|---|---|
| PubChem CID | 143782895 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 8-[5-[[6-amino-8-[(6-methyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]methyl]-1H-imidazol-2-yl]octan-2-one |
| SMILES | CC(=O)CCCCCCc1ncc(Cn2c(Sc3cc4c(cc3C)OCO4)nc3c(N)ncnc32)[nH]1 |
| InChI | InChI=1S/C25H29N7O3S/c1-15-9-18-19(35-14-34-18)10-20(15)36-25-31-22-23(26)28-13-29-24(22)32(25)12-17-11-27-21(30-17)8-6-4-3-5-7-16(2)33/h9-11,13H,3-8,12,14H2,1-2H3,(H,27,30)(H2,26,28,29) |
| InChIKey | LVEDRCFCUAXPCK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|