C40H34F8N2O2S2 — CID 143793434
(E)-[4-hexyl-5-[4-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]methylidenecarbamic acid (PubChem CID 143793434) has the molecular formula C40H34F8N2O2S2 and a molecular weight of 790.84 g/mol. Its IUPAC name is (E)-[4-hexyl-5-[4-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]methylidenecarbamic acid.
| Compound Name | (E)-[4-hexyl-5-[4-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]methylidenecarbamic acid |
|---|---|
| PubChem CID | 143793434 |
| Molecular Formula | C40H34F8N2O2S2 |
| Molecular Weight | 790.84 g/mol |
| Exact Mass | 790.19 |
| IUPAC Name | (E)-[4-hexyl-5-[4-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]methylidenecarbamic acid |
| SMILES | CCCCCCc1cc(-c2sc(/C=N/C(=O)O)cc2CCCCCC)sc1-c1ccc(-n2c3c(F)c(F)c(F)c(F)c3c3c(F)c(F)c(F)c(F)c32)cc1 |
| InChI | InChI=1S/C40H34F8N2O2S2/c1-3-5-7-9-11-21-17-24(19-49-40(51)52)53-39(21)25-18-22(12-10-8-6-4-2)38(54-25)20-13-15-23(16-14-20)50-36-26(28(41)30(43)32(45)34(36)47)27-29(42)31(44)33(46)35(48)37(27)50/h13-19H,3-12H2,1-2H3,(H,51,52)/b49-19+ |
| InChIKey | CCMJQIRGAYOLSC-CBRJURKLSA-N |
| XLogP | 13.70 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.84 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|