C12H17NO — CID 143794576
2-methyl-3-[(4Z)-5-methylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]propan-1-ol (PubChem CID 143794576) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-methyl-3-[(4Z)-5-methylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]propan-1-ol.
| Compound Name | 2-methyl-3-[(4Z)-5-methylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 143794576 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-methyl-3-[(4Z)-5-methylidene-4-prop-2-enylidene-1H-pyrrol-3-yl]propan-1-ol |
| SMILES | C=C/C=c1/c(CC(C)CO)c[nH]c1=C |
| InChI | InChI=1S/C12H17NO/c1-4-5-12-10(3)13-7-11(12)6-9(2)8-14/h4-5,7,9,13-14H,1,3,6,8H2,2H3/b12-5+ |
| InChIKey | MQGLHZLPUYQLOX-LFYBBSHMSA-N |
| XLogP | 0.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |