About (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide
(E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide (PubChem CID 143824134) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide |
| PubChem CID | 143824134 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide |
| SMILES | C=N/C=C\C(=C/C)\C(N=C)=N\C |
| InChI | InChI=1S/C9H13N3/c1-5-8(6-7-10-2)9(11-3)12-4/h5-7H,2-3H2,1,4H3/b7-6-,8-5+,12-9- |
| InChIKey | BTEZORQWQVGVOQ-AKKZRTOESA-N |
| XLogP | 1.88 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide?
The IUPAC name of (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide (CID 143824134) is (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide.
What is the SMILES notation for (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide?
The canonical SMILES for (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide is C=N/C=C\C(=C/C)\C(N=C)=N\C.
What is the InChIKey of (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide?
The InChIKey is BTEZORQWQVGVOQ-AKKZRTOESA-N. The full InChI is InChI=1S/C9H13N3/c1-5-8(6-7-10-2)9(11-3)12-4/h5-7H,2-3H2,1,4H3/b7-6-,8-5+,12-9-.
What are the key properties of (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide?
(E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide has a molecular weight of 163.22 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-methyl-N-methylidene-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enimidamide is sourced from PubChem (CID 143824134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).