C32H42N2OS — CID 143830028
10,13-dimethyl-3-methylidene-17-[3-[[5-methyl-4-[(1Z)-3-methylbuta-1,3-dienyl]-1H-imidazol-2-yl]sulfanyl]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-ol (PubChem CID 143830028) has the molecular formula C32H42N2OS and a molecular weight of 502.77 g/mol. Its IUPAC name is 10,13-dimethyl-3-methylidene-17-[3-[[5-methyl-4-[(1Z)-3-methylbuta-1,3-dienyl]-1H-imidazol-2-yl]sulfanyl]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-ol.
| Compound Name | 10,13-dimethyl-3-methylidene-17-[3-[[5-methyl-4-[(1Z)-3-methylbuta-1,3-dienyl]-1H-imidazol-2-yl]sulfanyl]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 143830028 |
| Molecular Formula | C32H42N2OS |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 10,13-dimethyl-3-methylidene-17-[3-[[5-methyl-4-[(1Z)-3-methylbuta-1,3-dienyl]-1H-imidazol-2-yl]sulfanyl]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-ol |
| SMILES | C=C1C=CC2(C)C(=C1)CCC1C2C(O)CC2(C)C(C(=C)CSc3nc(/C=C\C(=C)C)c(C)[nH]3)CCC12 |
| InChI | InChI=1S/C32H42N2OS/c1-19(2)8-13-27-22(5)33-30(34-27)36-18-21(4)25-11-12-26-24-10-9-23-16-20(3)14-15-31(23,6)29(24)28(35)17-32(25,26)7/h8,13-16,24-26,28-29,35H,1,3-4,9-12,17-18H2,2,5-7H3,(H,33,34)/b13-8- |
| InChIKey | KNTDCANNMLXNJO-JYRVWZFOSA-N |
| XLogP | 7.84 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|