C28H42N2S — CID 143830354
methanethiol;N-[(Z)-2-(methylideneamino)ethenyl]-2-(10,11,13-trimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)prop-2-en-1-amine (PubChem CID 143830354) has the molecular formula C28H42N2S and a molecular weight of 438.73 g/mol. Its IUPAC name is methanethiol;N-[(Z)-2-(methylideneamino)ethenyl]-2-(10,11,13-trimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)prop-2-en-1-amine.
| Compound Name | methanethiol;N-[(Z)-2-(methylideneamino)ethenyl]-2-(10,11,13-trimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 143830354 |
| Molecular Formula | C28H42N2S |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | methanethiol;N-[(Z)-2-(methylideneamino)ethenyl]-2-(10,11,13-trimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)prop-2-en-1-amine |
| SMILES | C=N/C=C\NCC(=C)C1CCC2C3CCC4=CC(=C)C=CC4(C)C3C(C)CC12C.CS |
| InChI | InChI=1S/C27H38N2.CH4S/c1-18-11-12-26(4)21(15-18)7-8-22-24-10-9-23(20(3)17-29-14-13-28-6)27(24,5)16-19(2)25(22)26;1-2/h11-15,19,22-25,29H,1,3,6-10,16-17H2,2,4-5H3;2H,1H3/b14-13-; |
| InChIKey | IWDQGGIQYDGQPQ-HPWRNOGASA-N |
| XLogP | 7.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|