C22H30N2O3 — CID 155062347
1-[(13R)-10,11-dimethyl-3-methylimino-13-nitroso-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone (PubChem CID 155062347) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(13R)-10,11-dimethyl-3-methylimino-13-nitroso-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone.
| Compound Name | 1-[(13R)-10,11-dimethyl-3-methylimino-13-nitroso-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 155062347 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-[(13R)-10,11-dimethyl-3-methylimino-13-nitroso-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-hydroxyethanone |
| SMILES | C/N=C1\C=CC2(C)C(=C1)CCC1C2C(C)C[C@]2(N=O)C(C(=O)CO)CCC12 |
| InChI | InChI=1S/C22H30N2O3/c1-13-11-22(24-27)17(6-7-18(22)19(26)12-25)16-5-4-14-10-15(23-3)8-9-21(14,2)20(13)16/h8-10,13,16-18,20,25H,4-7,11-12H2,1-3H3/b23-15+/t13?,16?,17?,18?,20?,21?,22-/m1/s1 |
| InChIKey | GRFYEJQDBXKBNM-LVJSNBOFSA-N |
| XLogP | 3.72 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|