C21H49N2OS+ — CID 143837795
[2,2-dimethyl-3-[(2,4,4-trimethyl-2-sulfanylpentanoyl)amino]propyl]-ethyl-dimethylazanium;ethane (PubChem CID 143837795) has the molecular formula C21H49N2OS+ and a molecular weight of 377.70 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(2,4,4-trimethyl-2-sulfanylpentanoyl)amino]propyl]-ethyl-dimethylazanium;ethane.
| Compound Name | [2,2-dimethyl-3-[(2,4,4-trimethyl-2-sulfanylpentanoyl)amino]propyl]-ethyl-dimethylazanium;ethane |
|---|---|
| PubChem CID | 143837795 |
| Molecular Formula | C21H49N2OS+ |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 377.36 |
| IUPAC Name | [2,2-dimethyl-3-[(2,4,4-trimethyl-2-sulfanylpentanoyl)amino]propyl]-ethyl-dimethylazanium;ethane |
| SMILES | CC.CC.CC[N+](C)(C)CC(C)(C)CNC(=O)C(C)(S)CC(C)(C)C |
| InChI | InChI=1S/C17H36N2OS.2C2H6/c1-10-19(8,9)13-16(5,6)12-18-14(20)17(7,21)11-15(2,3)4;2*1-2/h10-13H2,1-9H3,(H-,18,20,21);2*1-2H3/p+1 |
| InChIKey | NOVVFMVSDYDMRI-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|