C9H12N2 — CID 143838717
N-(3-ethenyl-1,4-dimethylpyrrol-2-yl)methanimine (PubChem CID 143838717) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N-(3-ethenyl-1,4-dimethylpyrrol-2-yl)methanimine.
| Compound Name | N-(3-ethenyl-1,4-dimethylpyrrol-2-yl)methanimine |
|---|---|
| PubChem CID | 143838717 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N-(3-ethenyl-1,4-dimethylpyrrol-2-yl)methanimine |
| SMILES | C=Cc1c(C)cn(C)c1N=C |
| InChI | InChI=1S/C9H12N2/c1-5-8-7(2)6-11(4)9(8)10-3/h5-6H,1,3H2,2,4H3 |
| InChIKey | AXCOLZYJDQDVPS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|