C22H35N3O2S — CID 143840630
tert-butyl N-[[(3Z,5Z)-3-ethenyl-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]hepta-3,5-dienyl]amino]carbamate (PubChem CID 143840630) has the molecular formula C22H35N3O2S and a molecular weight of 405.61 g/mol. Its IUPAC name is tert-butyl N-[[(3Z,5Z)-3-ethenyl-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]hepta-3,5-dienyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3Z,5Z)-3-ethenyl-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]hepta-3,5-dienyl]amino]carbamate |
|---|---|
| PubChem CID | 143840630 |
| Molecular Formula | C22H35N3O2S |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | tert-butyl N-[[(3Z,5Z)-3-ethenyl-5-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]hepta-3,5-dienyl]amino]carbamate |
| SMILES | C=C/C(=C\C(=C/C)CCc1csc(C(C)C)n1)CCNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O2S/c1-8-17(10-11-19-15-28-20(24-19)16(3)4)14-18(9-2)12-13-23-25-21(26)27-22(5,6)7/h8-9,14-16,23H,2,10-13H2,1,3-7H3,(H,25,26)/b17-8-,18-14+ |
| InChIKey | SDRCLCPMCTYVLX-UZCYSTGLSA-N |
| XLogP | 5.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|