C19H41NO11 — CID 143874032
(3S)-2-(2,2-dihydroxy-1-nitrosoethoxy)butane-1,3-diol;ethane;6-(hydroxymethyl)-5-pentan-3-yloxane-2,3,4-triol (PubChem CID 143874032) has the molecular formula C19H41NO11 and a molecular weight of 459.53 g/mol. Its IUPAC name is (3S)-2-(2,2-dihydroxy-1-nitrosoethoxy)butane-1,3-diol;ethane;6-(hydroxymethyl)-5-pentan-3-yloxane-2,3,4-triol.
| Compound Name | (3S)-2-(2,2-dihydroxy-1-nitrosoethoxy)butane-1,3-diol;ethane;6-(hydroxymethyl)-5-pentan-3-yloxane-2,3,4-triol |
|---|---|
| PubChem CID | 143874032 |
| Molecular Formula | C19H41NO11 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | (3S)-2-(2,2-dihydroxy-1-nitrosoethoxy)butane-1,3-diol;ethane;6-(hydroxymethyl)-5-pentan-3-yloxane-2,3,4-triol |
| SMILES | CC.CCC(CC)C1C(CO)OC(O)C(O)C1O.C[C@H](O)C(CO)OC(N=O)C(O)O |
| InChI | InChI=1S/C11H22O5.C6H13NO6.C2H6/c1-3-6(4-2)8-7(5-12)16-11(15)10(14)9(8)13;1-3(9)4(2-8)13-5(7-12)6(10)11;1-2/h6-15H,3-5H2,1-2H3;3-6,8-11H,2H2,1H3;1-2H3/t;3-,4?,5?;/m.0./s1 |
| InChIKey | OWCXXOZCZNALSC-QZLKWERTSA-N |
| XLogP | -1.36 |
| TPSA | 209.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|