C15H23NO6 — CID 143874753
cyclohexa-1,5-dien-1-ylmethyl formate;5-methoxy-4-(methylamino)-5-oxopentanoic acid (PubChem CID 143874753) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl formate;5-methoxy-4-(methylamino)-5-oxopentanoic acid.
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl formate;5-methoxy-4-(methylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143874753 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl formate;5-methoxy-4-(methylamino)-5-oxopentanoic acid |
| SMILES | CNC(CCC(=O)O)C(=O)OC.O=COCC1=CCCC=C1 |
| InChI | InChI=1S/C8H10O2.C7H13NO4/c9-7-10-6-8-4-2-1-3-5-8;1-8-5(7(11)12-2)3-4-6(9)10/h2,4-5,7H,1,3,6H2;5,8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | XFZYJLYBSOCEDH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|