C14H22N4O3S — CID 143880275
5-(ethylamino)-2-methoxybenzenesulfonamide;pyrrolidine-1-carbonitrile (PubChem CID 143880275) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 5-(ethylamino)-2-methoxybenzenesulfonamide;pyrrolidine-1-carbonitrile.
| Compound Name | 5-(ethylamino)-2-methoxybenzenesulfonamide;pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 143880275 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-(ethylamino)-2-methoxybenzenesulfonamide;pyrrolidine-1-carbonitrile |
| SMILES | CCNc1ccc(OC)c(S(N)(=O)=O)c1.N#CN1CCCC1 |
| InChI | InChI=1S/C9H14N2O3S.C5H8N2/c1-3-11-7-4-5-8(14-2)9(6-7)15(10,12)13;6-5-7-3-1-2-4-7/h4-6,11H,3H2,1-2H3,(H2,10,12,13);1-4H2 |
| InChIKey | CIYRTNIXWZJBNX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|