About 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile
2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile (PubChem CID 143880260) has the molecular formula C18H30N4O3S
and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile.
Molecular Properties
| Compound Name | 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile |
| PubChem CID | 143880260 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile |
| SMILES | CCC(C)CCNc1ccc(OC)c(S(N)(=O)=O)c1.N#CN1CCCC1 |
| InChI | InChI=1S/C13H22N2O3S.C5H8N2/c1-4-10(2)7-8-15-11-5-6-12(18-3)13(9-11)19(14,16)17;6-5-7-3-1-2-4-7/h5-6,9-10,15H,4,7-8H2,1-3H3,(H2,14,16,17);1-4H2 |
| InChIKey | KVZZVNADFLJBAF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile?
The IUPAC name of 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile (CID 143880260) is 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile.
What is the SMILES notation for 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile?
The canonical SMILES for 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile is CCC(C)CCNc1ccc(OC)c(S(N)(=O)=O)c1.N#CN1CCCC1.
What is the InChIKey of 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile?
The InChIKey is KVZZVNADFLJBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S.C5H8N2/c1-4-10(2)7-8-15-11-5-6-12(18-3)13(9-11)19(14,16)17;6-5-7-3-1-2-4-7/h5-6,9-10,15H,4,7-8H2,1-3H3,(H2,14,16,17);1-4H2.
What are the key properties of 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile?
2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile has a molecular weight of 382.53 g/mol, XLogP of 2.75, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile is sourced from PubChem (CID 143880260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).