C18H30N4O3S — CID 143880260
2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile (PubChem CID 143880260) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile.
| Compound Name | 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 143880260 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-methoxy-5-(3-methylpentylamino)benzenesulfonamide;pyrrolidine-1-carbonitrile |
| SMILES | CCC(C)CCNc1ccc(OC)c(S(N)(=O)=O)c1.N#CN1CCCC1 |
| InChI | InChI=1S/C13H22N2O3S.C5H8N2/c1-4-10(2)7-8-15-11-5-6-12(18-3)13(9-11)19(14,16)17;6-5-7-3-1-2-4-7/h5-6,9-10,15H,4,7-8H2,1-3H3,(H2,14,16,17);1-4H2 |
| InChIKey | KVZZVNADFLJBAF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|