C29H28F3N3O3 — CID 143893739
N-[[4-(3-hydroxyoxiran-2-yl)cyclohexyl]methyl]-1-(quinolin-7-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide (PubChem CID 143893739) has the molecular formula C29H28F3N3O3 and a molecular weight of 523.56 g/mol. Its IUPAC name is N-[[4-(3-hydroxyoxiran-2-yl)cyclohexyl]methyl]-1-(quinolin-7-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide.
| Compound Name | N-[[4-(3-hydroxyoxiran-2-yl)cyclohexyl]methyl]-1-(quinolin-7-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide |
|---|---|
| PubChem CID | 143893739 |
| Molecular Formula | C29H28F3N3O3 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[[4-(3-hydroxyoxiran-2-yl)cyclohexyl]methyl]-1-(quinolin-7-ylmethyl)-5-(trifluoromethyl)indole-7-carboxamide |
| SMILES | O=C(NCC1CCC(C2OC2O)CC1)c1cc(C(F)(F)F)cc2ccn(Cc3ccc4cccnc4c3)c12 |
| InChI | InChI=1S/C29H28F3N3O3/c30-29(31,32)22-13-21-9-11-35(16-18-5-6-19-2-1-10-33-24(19)12-18)25(21)23(14-22)27(36)34-15-17-3-7-20(8-4-17)26-28(37)38-26/h1-2,5-6,9-14,17,20,26,28,37H,3-4,7-8,15-16H2,(H,34,36) |
| InChIKey | XHMKNRKXSXQHBQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|