C15H12ClNS — CID 143895726
2-chloro-6-cyclohexa-1,5-dien-1-yl-4-thiophen-2-ylpyridine (PubChem CID 143895726) has the molecular formula C15H12ClNS and a molecular weight of 273.79 g/mol. Its IUPAC name is 2-chloro-6-cyclohexa-1,5-dien-1-yl-4-thiophen-2-ylpyridine.
| Compound Name | 2-chloro-6-cyclohexa-1,5-dien-1-yl-4-thiophen-2-ylpyridine |
|---|---|
| PubChem CID | 143895726 |
| Molecular Formula | C15H12ClNS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-chloro-6-cyclohexa-1,5-dien-1-yl-4-thiophen-2-ylpyridine |
| SMILES | Clc1cc(-c2cccs2)cc(C2=CCCC=C2)n1 |
| InChI | InChI=1S/C15H12ClNS/c16-15-10-12(14-7-4-8-18-14)9-13(17-15)11-5-2-1-3-6-11/h2,4-10H,1,3H2 |
| InChIKey | DTNABCGWXCOLBA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|