C23H29NO — CID 143907152
1-[(1Z)-buta-1,3-dienyl]-2-ethylbenzene;7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 143907152) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethylbenzene;7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethylbenzene;7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143907152 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethylbenzene;7-methoxy-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=C/C=C\c1ccccc1CC.COc1ccc2c(c1)CN(C)CC2 |
| InChI | InChI=1S/C12H14.C11H15NO/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-12-6-5-9-3-4-11(13-2)7-10(9)8-12/h3,5-10H,1,4H2,2H3;3-4,7H,5-6,8H2,1-2H3/b8-5-; |
| InChIKey | PNOFCXXNUQOXIF-HGKIGUAWSA-N |
| XLogP | 5.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|