C14H23NO2 — CID 144686175
acetaldehyde;ethane;5-methoxy-2-methyl-1,3-dihydroisoindole (PubChem CID 144686175) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is acetaldehyde;ethane;5-methoxy-2-methyl-1,3-dihydroisoindole.
| Compound Name | acetaldehyde;ethane;5-methoxy-2-methyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 144686175 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | acetaldehyde;ethane;5-methoxy-2-methyl-1,3-dihydroisoindole |
| SMILES | CC.CC=O.COc1ccc2c(c1)CN(C)C2 |
| InChI | InChI=1S/C10H13NO.C2H4O.C2H6/c1-11-6-8-3-4-10(12-2)5-9(8)7-11;1-2-3;1-2/h3-5H,6-7H2,1-2H3;2H,1H3;1-2H3 |
| InChIKey | ZKUWOHYBZZXTIR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|