C23H22N2O4 — CID 143918415
N-(1,3-benzodioxol-5-yl)-2,4-dihydroxy-N-phenyl-5-propan-2-ylbenzenecarboximidamide (PubChem CID 143918415) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,4-dihydroxy-N-phenyl-5-propan-2-ylbenzenecarboximidamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,4-dihydroxy-N-phenyl-5-propan-2-ylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143918415 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,4-dihydroxy-N-phenyl-5-propan-2-ylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H22N2O4/c1-14(2)17-11-18(20(27)12-19(17)26)23(24)25(15-6-4-3-5-7-15)16-8-9-21-22(10-16)29-13-28-21/h3-12,14,24,26-27H,13H2,1-2H3/b24-23+ |
| InChIKey | UMEHMBMZTPXYBN-WCWDXBQESA-N |
| XLogP | 5.11 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|