C24H24N2O6S — CID 123766851
N'-[2-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]benzenesulfonohydrazide (PubChem CID 123766851) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]benzenesulfonohydrazide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]benzenesulfonohydrazide |
|---|---|
| PubChem CID | 123766851 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)ethenyl]benzenesulfonohydrazide |
| SMILES | CC(C)c1cc(C(=Cc2ccc3c(c2)OCO3)NNS(=O)(=O)c2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C24H24N2O6S/c1-15(2)18-12-19(22(28)13-21(18)27)20(10-16-8-9-23-24(11-16)32-14-31-23)25-26-33(29,30)17-6-4-3-5-7-17/h3-13,15,25-28H,14H2,1-2H3 |
| InChIKey | QJXCMSDZZYLQOD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|