C24H28N6O — CID 143921719
N-[4-(3-ethylanilino)quinazolin-6-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 143921719) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[4-(3-ethylanilino)quinazolin-6-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | N-[4-(3-ethylanilino)quinazolin-6-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 143921719 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[4-(3-ethylanilino)quinazolin-6-yl]-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCc1cccc(Nc2ncnc3ccc(NC(=O)N4CC5CN(C)CC5C4)cc23)c1 |
| InChI | InChI=1S/C24H28N6O/c1-3-16-5-4-6-19(9-16)27-23-21-10-20(7-8-22(21)25-15-26-23)28-24(31)30-13-17-11-29(2)12-18(17)14-30/h4-10,15,17-18H,3,11-14H2,1-2H3,(H,28,31)(H,25,26,27) |
| InChIKey | DJSZDMPFLHEEDF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |