C22H27N — CID 143924438
(1Z,4E,6E,8Z)-N,6-dimethyl-3-methylidene-N-[1-(4-methylphenyl)ethenyl]deca-1,4,6,8-tetraen-1-amine (PubChem CID 143924438) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is (1Z,4E,6E,8Z)-N,6-dimethyl-3-methylidene-N-[1-(4-methylphenyl)ethenyl]deca-1,4,6,8-tetraen-1-amine.
| Compound Name | (1Z,4E,6E,8Z)-N,6-dimethyl-3-methylidene-N-[1-(4-methylphenyl)ethenyl]deca-1,4,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 143924438 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (1Z,4E,6E,8Z)-N,6-dimethyl-3-methylidene-N-[1-(4-methylphenyl)ethenyl]deca-1,4,6,8-tetraen-1-amine |
| SMILES | C=C(/C=C\N(C)C(=C)c1ccc(C)cc1)/C=C/C(C)=C/C=C\C |
| InChI | InChI=1S/C22H27N/c1-7-8-9-18(2)10-11-20(4)16-17-23(6)21(5)22-14-12-19(3)13-15-22/h7-17H,4-5H2,1-3,6H3/b8-7-,11-10+,17-16-,18-9+ |
| InChIKey | HYESVOBOEJDATP-VBAQZBJKSA-N |
| XLogP | 6.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|