C19H16F2O3 — CID 143924836
2-(2-acetylcyclobutyl)-5-(2,4-difluorophenyl)benzoic acid (PubChem CID 143924836) has the molecular formula C19H16F2O3 and a molecular weight of 330.33 g/mol. Its IUPAC name is 2-(2-acetylcyclobutyl)-5-(2,4-difluorophenyl)benzoic acid.
| Compound Name | 2-(2-acetylcyclobutyl)-5-(2,4-difluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 143924836 |
| Molecular Formula | C19H16F2O3 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(2-acetylcyclobutyl)-5-(2,4-difluorophenyl)benzoic acid |
| SMILES | CC(=O)C1CCC1c1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C19H16F2O3/c1-10(22)13-6-7-15(13)16-4-2-11(8-17(16)19(23)24)14-5-3-12(20)9-18(14)21/h2-5,8-9,13,15H,6-7H2,1H3,(H,23,24) |
| InChIKey | NQFMSEWHOPTKAY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |