C12H20FNO — CID 143933260
ethene;(3Z,5Z)-5-[2-(fluoromethylamino)ethyl]hepta-1,3,5-trien-2-ol (PubChem CID 143933260) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is ethene;(3Z,5Z)-5-[2-(fluoromethylamino)ethyl]hepta-1,3,5-trien-2-ol.
| Compound Name | ethene;(3Z,5Z)-5-[2-(fluoromethylamino)ethyl]hepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143933260 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | ethene;(3Z,5Z)-5-[2-(fluoromethylamino)ethyl]hepta-1,3,5-trien-2-ol |
| SMILES | C=C.C=C(O)/C=C\C(=C/C)CCNCF |
| InChI | InChI=1S/C10H16FNO.C2H4/c1-3-10(5-4-9(2)13)6-7-12-8-11;1-2/h3-5,12-13H,2,6-8H2,1H3;1-2H2/b5-4-,10-3+; |
| InChIKey | CJZWVMZBPMMTIM-MOPJUJGYSA-N |
| XLogP | 3.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|