C11H21NO2 — CID 144546705
ethane;(3E)-7-(methylamino)-5-methylidenehepta-1,3-diene-2,3-diol (PubChem CID 144546705) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is ethane;(3E)-7-(methylamino)-5-methylidenehepta-1,3-diene-2,3-diol.
| Compound Name | ethane;(3E)-7-(methylamino)-5-methylidenehepta-1,3-diene-2,3-diol |
|---|---|
| PubChem CID | 144546705 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethane;(3E)-7-(methylamino)-5-methylidenehepta-1,3-diene-2,3-diol |
| SMILES | C=C(/C=C(/O)C(=C)O)CCNC.CC |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-7(4-5-10-3)6-9(12)8(2)11;1-2/h6,10-12H,1-2,4-5H2,3H3;1-2H3/b9-6+; |
| InChIKey | LJOISEXBBDGNAR-MLBSPLJJSA-N |
| XLogP | 2.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|