C22H30 — CID 143934062
(3Z,7Z,11E)-2,12-dimethyl-5,6-dimethylidene-7-(2-methylprop-2-enylidene)tetradeca-1,3,11,13-tetraene (PubChem CID 143934062) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is (3Z,7Z,11E)-2,12-dimethyl-5,6-dimethylidene-7-(2-methylprop-2-enylidene)tetradeca-1,3,11,13-tetraene.
| Compound Name | (3Z,7Z,11E)-2,12-dimethyl-5,6-dimethylidene-7-(2-methylprop-2-enylidene)tetradeca-1,3,11,13-tetraene |
|---|---|
| PubChem CID | 143934062 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | (3Z,7Z,11E)-2,12-dimethyl-5,6-dimethylidene-7-(2-methylprop-2-enylidene)tetradeca-1,3,11,13-tetraene |
| SMILES | C=C/C(C)=C/CCC/C(=C/C(=C)C)C(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C22H30/c1-9-19(6)12-10-11-13-22(16-18(4)5)21(8)20(7)15-14-17(2)3/h9,12,14-16H,1-2,4,7-8,10-11,13H2,3,5-6H3/b15-14-,19-12+,22-16- |
| InChIKey | GJKGKANBJAWNAW-QWZRFQQFSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|