C3H4N4OS — CID 143941303
2-sulfanyl-1,2,4-triazole-3-carboxamide (PubChem CID 143941303) has the molecular formula C3H4N4OS and a molecular weight of 144.16 g/mol. Its IUPAC name is 2-sulfanyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-sulfanyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 143941303 |
| Molecular Formula | C3H4N4OS |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.01 |
| IUPAC Name | 2-sulfanyl-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncnn1S |
| InChI | InChI=1S/C3H4N4OS/c4-2(8)3-5-1-6-7(3)9/h1,9H,(H2,4,8) |
| InChIKey | CRFLOCZWXPIGAM-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|