C17H20N4O7 — CID 143947233
(15S)-4,7,10,13-tetraoxo-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid (PubChem CID 143947233) has the molecular formula C17H20N4O7 and a molecular weight of 392.37 g/mol. Its IUPAC name is (15S)-4,7,10,13-tetraoxo-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid.
| Compound Name | (15S)-4,7,10,13-tetraoxo-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
|---|---|
| PubChem CID | 143947233 |
| Molecular Formula | C17H20N4O7 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (15S)-4,7,10,13-tetraoxo-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
| SMILES | O=C1CNC(=O)COc2ccc(cc2)C[C@@H](C(=O)O)NC(=O)CNC(=O)CN1 |
| InChI | InChI=1S/C17H20N4O7/c22-13-6-18-14(23)7-20-16(25)9-28-11-3-1-10(2-4-11)5-12(17(26)27)21-15(24)8-19-13/h1-4,12H,5-9H2,(H,18,23)(H,19,22)(H,20,25)(H,21,24)(H,26,27)/t12-/m0/s1 |
| InChIKey | DNTIVIOZGRVIRG-LBPRGKRZSA-N |
| XLogP | -2.46 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|