About potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine
potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine (PubChem CID 143953103) has the molecular formula C17H27KN2
and a molecular weight of 298.52 g/mol. Its IUPAC name is potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine.
Molecular Properties
| Compound Name | potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine |
| PubChem CID | 143953103 |
| Molecular Formula | C17H27KN2 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine |
| SMILES | CC.CC.CC.[H]/N=C/c1c(C=C)[n-]c2ccccc12.[K+] |
| InChI | InChI=1S/C11H9N2.3C2H6.K/c1-2-10-9(7-12)8-5-3-4-6-11(8)13-10;3*1-2;/h2-7,12H,1H2;3*1-2H3;/q-1;;;;+1/b12-7+;;;; |
| InChIKey | SCJQIWKDCWOHFI-BLSNBFPRSA-N |
| XLogP | 2.52 |
| TPSA | 37.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine?
The IUPAC name of potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine (CID 143953103) is potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine.
What is the SMILES notation for potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine?
The canonical SMILES for potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine is CC.CC.CC.[H]/N=C/c1c(C=C)[n-]c2ccccc12.[K+].
What is the InChIKey of potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine?
The InChIKey is SCJQIWKDCWOHFI-BLSNBFPRSA-N. The full InChI is InChI=1S/C11H9N2.3C2H6.K/c1-2-10-9(7-12)8-5-3-4-6-11(8)13-10;3*1-2;/h2-7,12H,1H2;3*1-2H3;/q-1;;;;+1/b12-7+;;;;.
What are the key properties of potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine?
potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine has a molecular weight of 298.52 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethane;(2-ethenylindol-1-id-3-yl)methanimine is sourced from PubChem (CID 143953103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).