C15H26FN3 — CID 143961810
(3Z,5E)-6-(4-ethylpiperazin-1-yl)-2-fluoro-2-methylocta-3,5,7-trien-3-amine (PubChem CID 143961810) has the molecular formula C15H26FN3 and a molecular weight of 267.39 g/mol. Its IUPAC name is (3Z,5E)-6-(4-ethylpiperazin-1-yl)-2-fluoro-2-methylocta-3,5,7-trien-3-amine.
| Compound Name | (3Z,5E)-6-(4-ethylpiperazin-1-yl)-2-fluoro-2-methylocta-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 143961810 |
| Molecular Formula | C15H26FN3 |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | (3Z,5E)-6-(4-ethylpiperazin-1-yl)-2-fluoro-2-methylocta-3,5,7-trien-3-amine |
| SMILES | C=C/C(=C\C=C(/N)C(C)(C)F)N1CCN(CC)CC1 |
| InChI | InChI=1S/C15H26FN3/c1-5-13(7-8-14(17)15(3,4)16)19-11-9-18(6-2)10-12-19/h5,7-8H,1,6,9-12,17H2,2-4H3/b13-7+,14-8- |
| InChIKey | HGAONVGVCBGMAX-GUZOQHLSSA-N |
| XLogP | 2.28 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|