About 2-butyl-N-ethynylaniline
2-butyl-N-ethynylaniline (PubChem CID 143963108) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-butyl-N-ethynylaniline.
Molecular Properties
| Compound Name | 2-butyl-N-ethynylaniline |
| PubChem CID | 143963108 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-butyl-N-ethynylaniline |
| SMILES | C#CNc1ccccc1CCCC |
| InChI | InChI=1S/C12H15N/c1-3-5-8-11-9-6-7-10-12(11)13-4-2/h2,6-7,9-10,13H,3,5,8H2,1H3 |
| InChIKey | ZWGZCILVHXRDNO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-N-ethynylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N-ethynylaniline?
The IUPAC name of 2-butyl-N-ethynylaniline (CID 143963108) is 2-butyl-N-ethynylaniline.
What is the SMILES notation for 2-butyl-N-ethynylaniline?
The canonical SMILES for 2-butyl-N-ethynylaniline is C#CNc1ccccc1CCCC.
What is the InChIKey of 2-butyl-N-ethynylaniline?
The InChIKey is ZWGZCILVHXRDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-3-5-8-11-9-6-7-10-12(11)13-4-2/h2,6-7,9-10,13H,3,5,8H2,1H3.
What are the key properties of 2-butyl-N-ethynylaniline?
2-butyl-N-ethynylaniline has a molecular weight of 173.26 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N-ethynylaniline is sourced from PubChem (CID 143963108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).