C10H11F3O2S — CID 143964350
(1E,3E)-1-prop-2-enylsulfonyl-3-(trifluoromethyl)hexa-1,3,5-triene (PubChem CID 143964350) has the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is (1E,3E)-1-prop-2-enylsulfonyl-3-(trifluoromethyl)hexa-1,3,5-triene.
| Compound Name | (1E,3E)-1-prop-2-enylsulfonyl-3-(trifluoromethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143964350 |
| Molecular Formula | C10H11F3O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (1E,3E)-1-prop-2-enylsulfonyl-3-(trifluoromethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C\S(=O)(=O)CC=C)C(F)(F)F |
| InChI | InChI=1S/C10H11F3O2S/c1-3-5-9(10(11,12)13)6-8-16(14,15)7-4-2/h3-6,8H,1-2,7H2/b8-6+,9-5+ |
| InChIKey | WVJUZKCYRCBTJF-RFSWUZDDSA-N |
| XLogP | 2.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|