C8H8ClF3O2S — CID 143835645
(2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-2-sulfonyl chloride (PubChem CID 143835645) has the molecular formula C8H8ClF3O2S and a molecular weight of 260.66 g/mol. Its IUPAC name is (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-2-sulfonyl chloride.
| Compound Name | (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 143835645 |
| Molecular Formula | C8H8ClF3O2S |
| Molecular Weight | 260.66 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (2E,4E)-5-(trifluoromethyl)hepta-2,4,6-triene-2-sulfonyl chloride |
| SMILES | C=C/C(=C\C=C(/C)S(=O)(=O)Cl)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF3O2S/c1-3-7(8(10,11)12)5-4-6(2)15(9,13)14/h3-5H,1H2,2H3/b6-4+,7-5+ |
| InChIKey | UMHQALDQTSCTJH-YDFGWWAZSA-N |
| XLogP | 3.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|