C9H8F6O3S — CID 123944203
1,1,1-trifluoro-6-(trifluoromethyl)octa-2,4,6-triene-4-sulfonic acid (PubChem CID 123944203) has the molecular formula C9H8F6O3S and a molecular weight of 310.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-(trifluoromethyl)octa-2,4,6-triene-4-sulfonic acid.
| Compound Name | 1,1,1-trifluoro-6-(trifluoromethyl)octa-2,4,6-triene-4-sulfonic acid |
|---|---|
| PubChem CID | 123944203 |
| Molecular Formula | C9H8F6O3S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1,1,1-trifluoro-6-(trifluoromethyl)octa-2,4,6-triene-4-sulfonic acid |
| SMILES | CC=C(C=C(C=CC(F)(F)F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H8F6O3S/c1-2-6(9(13,14)15)5-7(19(16,17)18)3-4-8(10,11)12/h2-5H,1H3,(H,16,17,18) |
| InChIKey | GCZNJVMTAKNGHA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|