C8H8F6O2S — CID 118400661
(2Z,4E)-1,1,1-trifluoro-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene (PubChem CID 118400661) has the molecular formula C8H8F6O2S and a molecular weight of 282.20 g/mol. Its IUPAC name is (2Z,4E)-1,1,1-trifluoro-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene.
| Compound Name | (2Z,4E)-1,1,1-trifluoro-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 118400661 |
| Molecular Formula | C8H8F6O2S |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (2Z,4E)-1,1,1-trifluoro-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene |
| SMILES | C/C=C(C)/C=C(/C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F6O2S/c1-3-5(2)4-6(7(9,10)11)17(15,16)8(12,13)14/h3-4H,1-2H3/b5-3+,6-4- |
| InChIKey | AJRLCSOZHRRJGT-UZNMPDEFSA-N |
| XLogP | 3.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|