C13H25NO — CID 143966341
ethane;(3Z)-N-(2-methoxyethyl)-N,3-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 143966341) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;(3Z)-N-(2-methoxyethyl)-N,3-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | ethane;(3Z)-N-(2-methoxyethyl)-N,3-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143966341 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;(3Z)-N-(2-methoxyethyl)-N,3-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C(/C)C(=C)N(C)CCOC.CC |
| InChI | InChI=1S/C11H19NO.C2H6/c1-6-7-10(2)11(3)12(4)8-9-13-5;1-2/h6-7H,1,3,8-9H2,2,4-5H3;1-2H3/b10-7-; |
| InChIKey | IMJVMGJPIDGFBF-VEZAGKLZSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|