About (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine
(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine (PubChem CID 143969301) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine.
Molecular Properties
| Compound Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine |
| PubChem CID | 143969301 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine |
| SMILES | C=C/C=c1/cncc/c1=C/C.CN |
| InChI | InChI=1S/C10H11N.CH5N/c1-3-5-10-8-11-7-6-9(10)4-2;1-2/h3-8H,1H2,2H3;2H2,1H3/b9-4-,10-5-; |
| InChIKey | OYRHTVHIXHTSNI-DRWVTRDWSA-N |
| XLogP | 0.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine?
The IUPAC name of (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine (CID 143969301) is (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine.
What is the SMILES notation for (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine?
The canonical SMILES for (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine is C=C/C=c1/cncc/c1=C/C.CN.
What is the InChIKey of (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine?
The InChIKey is OYRHTVHIXHTSNI-DRWVTRDWSA-N. The full InChI is InChI=1S/C10H11N.CH5N/c1-3-5-10-8-11-7-6-9(10)4-2;1-2/h3-8H,1H2,2H3;2H2,1H3/b9-4-,10-5-;.
What are the key properties of (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine?
(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine has a molecular weight of 176.26 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine;methanamine is sourced from PubChem (CID 143969301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).