C26H31N5O5S — CID 143989999
5-[5-[2-(dimethylamino)ethylamino]sulfanyl-1-benzofuran-2-yl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one (PubChem CID 143989999) has the molecular formula C26H31N5O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is 5-[5-[2-(dimethylamino)ethylamino]sulfanyl-1-benzofuran-2-yl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one.
| Compound Name | 5-[5-[2-(dimethylamino)ethylamino]sulfanyl-1-benzofuran-2-yl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 143989999 |
| Molecular Formula | C26H31N5O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 5-[5-[2-(dimethylamino)ethylamino]sulfanyl-1-benzofuran-2-yl]imidazolidine-2,4-dione;5-methoxy-2-methyl-1,8-dihydrocyclohepta[c]pyrrol-3-one |
| SMILES | CN(C)CCNSc1ccc2oc(C3NC(=O)NC3=O)cc2c1.COC1=CC2=C(CC=C1)CN(C)C2=O |
| InChI | InChI=1S/C15H18N4O3S.C11H13NO2/c1-19(2)6-5-16-23-10-3-4-11-9(7-10)8-12(22-11)13-14(20)18-15(21)17-13;1-12-7-8-4-3-5-9(14-2)6-10(8)11(12)13/h3-4,7-8,13,16H,5-6H2,1-2H3,(H2,17,18,20,21);3,5-6H,4,7H2,1-2H3 |
| InChIKey | KGMCRAOPDFHLKB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|