C15H24O5 — CID 14411692
[2-ethyl-2-(5-hydroxy-3-oxohexyl)-3-oxocyclopentyl] acetate (PubChem CID 14411692) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [2-ethyl-2-(5-hydroxy-3-oxohexyl)-3-oxocyclopentyl] acetate.
| Compound Name | [2-ethyl-2-(5-hydroxy-3-oxohexyl)-3-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 14411692 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [2-ethyl-2-(5-hydroxy-3-oxohexyl)-3-oxocyclopentyl] acetate |
| SMILES | CCC1(CCC(=O)CC(C)O)C(=O)CCC1OC(C)=O |
| InChI | InChI=1S/C15H24O5/c1-4-15(8-7-12(18)9-10(2)16)13(19)5-6-14(15)20-11(3)17/h10,14,16H,4-9H2,1-3H3 |
| InChIKey | GEYJOBLMVMQKBW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |