C24H32O5 — CID 10386276
[(2S,4aS,10aS)-7-acetyloxy-1,1,4a-trimethyl-4-oxo-8-propan-2-yl-3,9,10,10a-tetrahydro-2H-phenanthren-2-yl] acetate (PubChem CID 10386276) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(2S,4aS,10aS)-7-acetyloxy-1,1,4a-trimethyl-4-oxo-8-propan-2-yl-3,9,10,10a-tetrahydro-2H-phenanthren-2-yl] acetate.
| Compound Name | [(2S,4aS,10aS)-7-acetyloxy-1,1,4a-trimethyl-4-oxo-8-propan-2-yl-3,9,10,10a-tetrahydro-2H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 10386276 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(2S,4aS,10aS)-7-acetyloxy-1,1,4a-trimethyl-4-oxo-8-propan-2-yl-3,9,10,10a-tetrahydro-2H-phenanthren-2-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C(C)C)CC[C@H]1C(C)(C)[C@@H](OC(C)=O)CC(=O)[C@]21C |
| InChI | InChI=1S/C24H32O5/c1-13(2)22-16-8-11-19-23(5,6)21(29-15(4)26)12-20(27)24(19,7)17(16)9-10-18(22)28-14(3)25/h9-10,13,19,21H,8,11-12H2,1-7H3/t19-,21-,24+/m0/s1 |
| InChIKey | BWNLUCGRXFXRAO-ZCVJKFOLSA-N |
| XLogP | 4.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|