About ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]
ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] (PubChem CID 144506452) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane].
Molecular Properties
| Compound Name | ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] |
| PubChem CID | 144506452 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] |
| SMILES | CC.COc1ccc(C)c2c1CC1(CC1)C2 |
| InChI | InChI=1S/C13H16O.C2H6/c1-9-3-4-12(14-2)11-8-13(5-6-13)7-10(9)11;1-2/h3-4H,5-8H2,1-2H3;1-2H3 |
| InChIKey | XYEVGHDSWMFTKF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]?
The IUPAC name of ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] (CID 144506452) is ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane].
What is the SMILES notation for ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]?
The canonical SMILES for ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] is CC.COc1ccc(C)c2c1CC1(CC1)C2.
What is the InChIKey of ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]?
The InChIKey is XYEVGHDSWMFTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O.C2H6/c1-9-3-4-12(14-2)11-8-13(5-6-13)7-10(9)11;1-2/h3-4H,5-8H2,1-2H3;1-2H3.
What are the key properties of ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane]?
ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] has a molecular weight of 218.34 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-7-methylspiro[1,3-dihydroindene-2,1'-cyclopropane] is sourced from PubChem (CID 144506452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).